CAS 2122856-65-7 is the registry number for Ethyl 3-(4-bromophenyl)-4,4,4-trifluorobut-2-enoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Ethyl (Z)-3-(4-bromophenyl)-4,4,4-trifluorobut-2-enoate (CAS 2122856-65-7) is a chemical compound with the molecular formula C12H10BrF3O2 and a molecular weight of 323.10 g/mol. IUPAC name: ethyl (Z)-3-(4-bromophenyl)-4,4,4-trifluorobut-2-enoate. InChIKey: GVBGGDBGUKPIEX-YFHOEESVSA-N.
| Molecular formula | C12H10BrF3O2 |
|---|---|
| Molecular weight | 323.10 g/mol |
| IUPAC name | ethyl (Z)-3-(4-bromophenyl)-4,4,4-trifluorobut-2-enoate |
| InChIKey | GVBGGDBGUKPIEX-YFHOEESVSA-N |
| SMILES | CCOC(=O)/C=C(/C1=CC=C(C=C1)Br)\C(F)(F)F |
Computed by PubChem (NCBI)