CAS 21231-80-1 is the registry number for (2,2-dichloroacetyl)-L-tyrosine. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[(2,2-dichloroacetyl)amino]-3-(4-hydroxyphenyl)propanoic acid (CAS 21231-80-1) is a chemical compound with the molecular formula C11H11Cl2NO4 and a molecular weight of 292.11 g/mol. IUPAC name: (2S)-2-[(2,2-dichloroacetyl)amino]-3-(4-hydroxyphenyl)propanoic acid. InChIKey: CHIQLHPWPPRMFG-QMMMGPOBSA-N.
| Molecular formula | C11H11Cl2NO4 |
|---|---|
| Molecular weight | 292.11 g/mol |
| IUPAC name | (2S)-2-[(2,2-dichloroacetyl)amino]-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | CHIQLHPWPPRMFG-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)NC(=O)C(Cl)Cl)O |
Computed by PubChem (NCBI)