CAS 212321-78-3 appears in our catalog under these names: Desethyl Dabigatran Etexilate, Desethyl Dabigatran Etexilate, >95% (HPLC), Desethyldabigatran Etexilate, BIBR 1087 SE/ 99.92% (existing batch purity), BIBR 1087 SE (Desethyl Dabigatran Etexilate). Offered by: Chemat Brand, TRC, Mikromol, TargetMol, GLPBio. Available pack sizes: on request, 50mg, 5mg, 25mg, 1mg, 10mg, 100mg, 200mg.
3-[[2-[[4-(N-hexoxycarbonylcarbamimidoyl)anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoic acid (CAS 212321-78-3) is a chemical compound with the molecular formula C32H37N7O5 and a molecular weight of 599.7 g/mol. IUPAC name: 3-[[2-[[4-(N-hexoxycarbonylcarbamimidoyl)anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoic acid. InChIKey: UGEWTLXHMYKLCO-UHFFFAOYSA-N.
| Molecular formula | C32H37N7O5 |
|---|---|
| Molecular weight | 599.7 g/mol |
| IUPAC name | 3-[[2-[[4-(N-hexoxycarbonylcarbamimidoyl)anilino]methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoic acid |
| InChIKey | UGEWTLXHMYKLCO-UHFFFAOYSA-N |
| SMILES | CCCCCCOC(=O)NC(=N)C1=CC=C(C=C1)NCC2=NC3=C(N2C)C=CC(=C3)C(=O)N(CCC(=O)O)C4=CC=CC=N4 |
Computed by PubChem (NCBI)