Products 212322-77-5
CAS 212322-77-5 appears in our catalog under these names: Dabigatran Etexilate Impurity 87, Dabigatran Impurity 34. Offered by: Chemat Brand. Available pack sizes: on request.
3-[[2-[(4-cyanoanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoic acid (CAS 212322-77-5) is a chemical compound with the molecular formula C25H22N6O3 and a molecular weight of 454.5 g/mol. IUPAC name: 3-[[2-[(4-cyanoanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoic acid. InChIKey: RTTVEDNJNQCLFS-UHFFFAOYSA-N.
| Molecular formula | C25H22N6O3 |
|---|---|
| Molecular weight | 454.5 g/mol |
| IUPAC name | 3-[[2-[(4-cyanoanilino)methyl]-1-methylbenzimidazole-5-carbonyl]-pyridin-2-ylamino]propanoic acid |
| InChIKey | RTTVEDNJNQCLFS-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C(=O)N(CCC(=O)O)C3=CC=CC=N3)N=C1CNC4=CC=C(C=C4)C#N |
Computed by PubChem (NCBI)