CAS 212332-35-9 appears in our catalog under these names: (E)-4-(5-Ethoxypyridin-3-yl)-N-methylbut-3-en-1-amine sesquifumarate, 98%, TC 2559 Fumarate, TC 2559 difumarate, TC 2559 difumarate, TC-2559 (fumarate). Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 2,5mg, 50mg, 1mg, 25mg, 10mg, 1 mg.
Bis((E)-but-2-enedioic acid);(E)-4-(5-ethoxy-3-pyridinyl)-N-methylbut-3-en-1-amine (CAS 212332-35-9) is a chemical compound with the molecular formula C20H26N2O9 and a molecular weight of 438.4 g/mol. IUPAC name: bis((E)-but-2-enedioic acid);(E)-4-(5-ethoxy-3-pyridinyl)-N-methylbut-3-en-1-amine. InChIKey: GEWVPSJQGJBDLM-MYBAKCFCSA-N.
| Molecular formula | C20H26N2O9 |
|---|---|
| Molecular weight | 438.4 g/mol |
| IUPAC name | bis((E)-but-2-enedioic acid);(E)-4-(5-ethoxy-3-pyridinyl)-N-methylbut-3-en-1-amine |
| InChIKey | GEWVPSJQGJBDLM-MYBAKCFCSA-N |
| SMILES | CCOC1=CN=CC(=C1)/C=C/CCNC.C(=C/C(=O)O)\C(=O)O.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)