CAS 21236-68-0 is the registry number for 2-Methyl Harmine. Offered by: TRC. Available pack sizes: 1g.
7-methoxy-1,2-dimethyl-9H-pyrido[3,4-b]indol-2-ium (CAS 21236-68-0) is a chemical compound with the molecular formula C14H15N2O+ and a molecular weight of 227.28 g/mol. IUPAC name: 7-methoxy-1,2-dimethyl-9H-pyrido[3,4-b]indol-2-ium. InChIKey: SNPOLGTUMADPOR-UHFFFAOYSA-O.
| Molecular formula | C14H15N2O+ |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | 7-methoxy-1,2-dimethyl-9H-pyrido[3,4-b]indol-2-ium |
| InChIKey | SNPOLGTUMADPOR-UHFFFAOYSA-O |
| SMILES | CC1=[N+](C=CC2=C1NC3=C2C=CC(=C3)OC)C |
Computed by PubChem (NCBI)