Products 21241-41-8
CAS 21241-41-8 is the registry number for 2-(Adamantan-1-ylformamido)acetic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(adamantane-1-carbonylamino)acetic acid (CAS 21241-41-8) is a chemical compound with the molecular formula C13H19NO3 and a molecular weight of 237.29 g/mol. IUPAC name: 2-(adamantane-1-carbonylamino)acetic acid. InChIKey: FGCTZJMAHLGRBY-UHFFFAOYSA-N.
| Molecular formula | C13H19NO3 |
|---|---|
| Molecular weight | 237.29 g/mol |
| IUPAC name | 2-(adamantane-1-carbonylamino)acetic acid |
| InChIKey | FGCTZJMAHLGRBY-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)NCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
[(Adamantane-1-carbonyl)-amino]-acetic acid, 2-(adamantane-1-carbonylamino)acetic acid, 2-(adamantan-1-ylformamido)acetic acid, 2-[(adamantan-1-yl)formamido]acetic acid, N-(Adamantan-1-ylcarbonyl)glycine, Enamine_003548, Oprea1_275625, (1-adamantanylcarbonylamino)acetic acid, 2-(adamantanylcarbonylamino)acetic acid, N-(tricyclo[3.3.1.1~3,7~]dec-1-ylcarbonyl)glycine