CAS 2124271-38-9 appears in our catalog under these names: Beta-Chloro-DL-alanine-d3, 2-Amino-3-chloropropanoic-2,3,3-d3 acid. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 25 mg, 2.5 mg.
2-amino-3-chloro-2,3,3-trideuteriopropanoic acid (CAS 2124271-38-9) is a chemical compound with the molecular formula C3H6ClNO2 and a molecular weight of 126.56 g/mol. IUPAC name: 2-amino-3-chloro-2,3,3-trideuteriopropanoic acid. InChIKey: ASBJGPTTYPEMLP-FUDHJZNOSA-N.
| Molecular formula | C3H6ClNO2 |
|---|---|
| Molecular weight | 126.56 g/mol |
| IUPAC name | 2-amino-3-chloro-2,3,3-trideuteriopropanoic acid |
| InChIKey | ASBJGPTTYPEMLP-FUDHJZNOSA-N |
| SMILES | [2H]C([2H])(C([2H])(C(=O)O)N)Cl |
Computed by PubChem (NCBI)