Products 2124272-52-0
CAS 2124272-52-0 is the registry number for 1,3,5-Tris(2,6-dimethylpyridin-4-yl)benzene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[3,5-bis(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine (CAS 2124272-52-0) is a chemical compound with the molecular formula C27H27N3 and a molecular weight of 393.5 g/mol. IUPAC name: 4-[3,5-bis(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine. InChIKey: BOIKPDINQBAJMN-UHFFFAOYSA-N.
| Molecular formula | C27H27N3 |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | 4-[3,5-bis(2,6-dimethyl-4-pyridinyl)phenyl]-2,6-dimethylpyridine |
| InChIKey | BOIKPDINQBAJMN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=N1)C)C2=CC(=CC(=C2)C3=CC(=NC(=C3)C)C)C4=CC(=NC(=C4)C)C |
Computed by PubChem (NCBI)