CAS 2124296-36-0 is the registry number for Nor Cisapride Hydrochloride. Offered by: TRC. Available pack sizes: 1mg.
4-amino-5-chloro-2-methoxy-N-[(3S,4R)-3-methoxypiperidin-4-yl]benzamide;hydrochloride (CAS 2124296-36-0) is a chemical compound with the molecular formula C14H21Cl2N3O3 and a molecular weight of 350.2 g/mol. IUPAC name: 4-amino-5-chloro-2-methoxy-N-[(3S,4R)-3-methoxypiperidin-4-yl]benzamide;hydrochloride. InChIKey: AHDLDHRUBZVPDI-YLAFAASESA-N.
| Molecular formula | C14H21Cl2N3O3 |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | 4-amino-5-chloro-2-methoxy-N-[(3S,4R)-3-methoxypiperidin-4-yl]benzamide;hydrochloride |
| InChIKey | AHDLDHRUBZVPDI-YLAFAASESA-N |
| SMILES | CO[C@H]1CNCC[C@H]1NC(=O)C2=CC(=C(C=C2OC)N)Cl.Cl |
Computed by PubChem (NCBI)