CAS 212505-49-2 appears in our catalog under these names: Rocuronium Bromide Impurity 40, Rocuronium bromide Impurity 42. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,2S,4R,6S,8S,11R,12S,16S)-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadec-14-en-15-yl] acetate (CAS 212505-49-2) is a chemical compound with the molecular formula C21H30O3 and a molecular weight of 330.5 g/mol. IUPAC name: [(1S,2S,4R,6S,8S,11R,12S,16S)-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadec-14-en-15-yl] acetate. InChIKey: XMUJPIDSOJTMMS-VTBMCCKRSA-N.
| Molecular formula | C21H30O3 |
|---|---|
| Molecular weight | 330.5 g/mol |
| IUPAC name | [(1S,2S,4R,6S,8S,11R,12S,16S)-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadec-14-en-15-yl] acetate |
| InChIKey | XMUJPIDSOJTMMS-VTBMCCKRSA-N |
| SMILES | CC(=O)OC1=CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(C[C@@H]5[C@H](C4)O5)C)C |
Computed by PubChem (NCBI)