CAS 212563-43-4 appears in our catalog under these names: 1-Iodo-1h,1h-perfluoroheptane, 95%, 1H,1H–Tridecafluoroheptyl Iodide, 1H,1H-Tridecafluoroheptyl Iodide, 1H,1H-Tridecafluoroheptyl Iodide, >95.0%(GC), 1-Iodo-1H,1H-perfluoroheptane. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 200mg, 10g.
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-7-iodoheptane (CAS 212563-43-4) is a chemical compound with the molecular formula C7H2F13I and a molecular weight of 459.97 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-7-iodoheptane. InChIKey: GBDROMNKGSCMDH-UHFFFAOYSA-N.
| Molecular formula | C7H2F13I |
|---|---|
| Molecular weight | 459.97 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-7-iodoheptane |
| InChIKey | GBDROMNKGSCMDH-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)I |
Computed by PubChem (NCBI)