CAS 2125669-94-3 is the registry number for 2,3,5,6-Tetrakis((4-aminophenyl)thio)terephthalonitrile, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2,3,5,6-tetrakis[(4-aminophenyl)sulfanyl]benzene-1,4-dicarbonitrile (CAS 2125669-94-3) is a chemical compound with the molecular formula C32H24N6S4 and a molecular weight of 620.8 g/mol. IUPAC name: 2,3,5,6-tetrakis[(4-aminophenyl)sulfanyl]benzene-1,4-dicarbonitrile. InChIKey: ZYJXUUVGMZMKCN-UHFFFAOYSA-N.
| Molecular formula | C32H24N6S4 |
|---|---|
| Molecular weight | 620.8 g/mol |
| IUPAC name | 2,3,5,6-tetrakis[(4-aminophenyl)sulfanyl]benzene-1,4-dicarbonitrile |
| InChIKey | ZYJXUUVGMZMKCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)SC2=C(C(=C(C(=C2SC3=CC=C(C=C3)N)C#N)SC4=CC=C(C=C4)N)SC5=CC=C(C=C5)N)C#N |
Computed by PubChem (NCBI)