CAS 21259-75-6 is the registry number for Mercury(+2) Trifluoromethanethiolate. Offered by: Biosynth. Available pack sizes: 20g, 30g.
Mercury(2+);bis(trifluoromethanethiolate) (CAS 21259-75-6) is a chemical compound with the molecular formula C2F6HgS2 and a molecular weight of 402.7 g/mol. IUPAC name: mercury(2+);bis(trifluoromethanethiolate). InChIKey: QHACEJBZGFEEJE-UHFFFAOYSA-L.
| Molecular formula | C2F6HgS2 |
|---|---|
| Molecular weight | 402.7 g/mol |
| IUPAC name | mercury(2+);bis(trifluoromethanethiolate) |
| InChIKey | QHACEJBZGFEEJE-UHFFFAOYSA-L |
| SMILES | C(F)(F)(F)[S-].C(F)(F)(F)[S-].[Hg+2] |
Computed by PubChem (NCBI)