CAS 2125944-56-9 is the registry number for 5-(7-(1-Bromoethyl)-2-benzofuranyl)-3-(1,1-dimethylethyl)-2-oxazolidinone. Offered by: TRC. Available pack sizes: 500mg.
5-[7-(1-bromoethyl)-1-benzofuran-2-yl]-3-tert-butyl-1,3-oxazolidin-2-one (CAS 2125944-56-9) is a chemical compound with the molecular formula C17H20BrNO3 and a molecular weight of 366.2 g/mol. IUPAC name: 5-[7-(1-bromoethyl)-1-benzofuran-2-yl]-3-tert-butyl-1,3-oxazolidin-2-one. InChIKey: JXRRVNSRXBCARR-UHFFFAOYSA-N.
| Molecular formula | C17H20BrNO3 |
|---|---|
| Molecular weight | 366.2 g/mol |
| IUPAC name | 5-[7-(1-bromoethyl)-1-benzofuran-2-yl]-3-tert-butyl-1,3-oxazolidin-2-one |
| InChIKey | JXRRVNSRXBCARR-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC2=C1OC(=C2)C3CN(C(=O)O3)C(C)(C)C)Br |
Computed by PubChem (NCBI)