Products 1498299-41-4

CAS 1498299-41-4 is the registry number for [2-(6-Bromo-naphthalen-2-yloxy)-ethyl]-carbamic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[2-(6-bromonaphthalen-2-yl)oxyethyl]carbamate (CAS 1498299-41-4) is a chemical compound with the molecular formula C17H20BrNO3 and a molecular weight of 366.2 g/mol. IUPAC name: tert-butyl N-[2-(6-bromonaphthalen-2-yl)oxyethyl]carbamate. InChIKey: MAHIOUFSBDAXPS-UHFFFAOYSA-N.

Identity
Molecular formulaC17H20BrNO3
Molecular weight366.2 g/mol
IUPAC nametert-butyl N-[2-(6-bromonaphthalen-2-yl)oxyethyl]carbamate
InChIKeyMAHIOUFSBDAXPS-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NCCOC1=CC2=C(C=C1)C=C(C=C2)Br

Computed by PubChem (NCBI)