CAS 2125947-85-3 is the registry number for Alpinin B. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-[(3R,5R)-7-(3,4-dihydroxyphenyl)-3,5-dihydroxyheptyl]-3-methoxybenzene-1,2-diol (CAS 2125947-85-3) is a chemical compound with the molecular formula C20H26O7 and a molecular weight of 378.4 g/mol. IUPAC name: 5-[(3R,5R)-7-(3,4-dihydroxyphenyl)-3,5-dihydroxyheptyl]-3-methoxybenzene-1,2-diol. InChIKey: WIYFRYZWZNPHDR-HUUCEWRRSA-N.
| Molecular formula | C20H26O7 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 5-[(3R,5R)-7-(3,4-dihydroxyphenyl)-3,5-dihydroxyheptyl]-3-methoxybenzene-1,2-diol |
| InChIKey | WIYFRYZWZNPHDR-HUUCEWRRSA-N |
| SMILES | COC1=CC(=CC(=C1O)O)CC[C@H](C[C@@H](CCC2=CC(=C(C=C2)O)O)O)O |
Computed by PubChem (NCBI)