CAS 2125955-70-4 appears in our catalog under these names: PXS-5120A, 98%, PXS-5120A/ 98.36% (existing batch purity), PXS–5120A, PXS-5120A, PXS-5120A, 98.12%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 25 mg.
1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[3-(dimethylsulfamoyl)phenyl]-2-methylindole-5-carboxylic acid;hydrochloride (CAS 2125955-70-4) is a chemical compound with the molecular formula C22H25ClFN3O4S and a molecular weight of 482.0 g/mol. IUPAC name: 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[3-(dimethylsulfamoyl)phenyl]-2-methylindole-5-carboxylic acid;hydrochloride. InChIKey: PWSRWJMEGVKWES-WPTDRQDKSA-N.
| Molecular formula | C22H25ClFN3O4S |
|---|---|
| Molecular weight | 482.0 g/mol |
| IUPAC name | 1-[(Z)-4-amino-2-fluorobut-2-enyl]-3-[3-(dimethylsulfamoyl)phenyl]-2-methylindole-5-carboxylic acid;hydrochloride |
| InChIKey | PWSRWJMEGVKWES-WPTDRQDKSA-N |
| SMILES | CC1=C(C2=C(N1C/C(=C/CN)/F)C=CC(=C2)C(=O)O)C3=CC(=CC=C3)S(=O)(=O)N(C)C.Cl |
Computed by PubChem (NCBI)