CAS 2126088-18-2 appears in our catalog under these names: (R)–2–Amino–2–(5–bromopyridin–2–yl)ethanol dihydrochloride, (R)-2-Amino-2-(5-bromopyridin-2-yl)ethanol dihydrochloride, 95%, (R)-2-Amino-2-(5-bromopyridin-2-yl)ethanol dihydrochloride, 97%, 97%, (R)-2-Amino-2-(5-bromopyridin-2-yl)ethan-1-ol dihydrochloride, 97%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(2R)-2-amino-2-(5-bromo-2-pyridinyl)ethanol;dihydrochloride (CAS 2126088-18-2) is a chemical compound with the molecular formula C7H11BrCl2N2O and a molecular weight of 289.98 g/mol. IUPAC name: (2R)-2-amino-2-(5-bromo-2-pyridinyl)ethanol;dihydrochloride. InChIKey: OISCRERGYJWDJN-ILKKLZGPSA-N.
| Molecular formula | C7H11BrCl2N2O |
|---|---|
| Molecular weight | 289.98 g/mol |
| IUPAC name | (2R)-2-amino-2-(5-bromo-2-pyridinyl)ethanol;dihydrochloride |
| InChIKey | OISCRERGYJWDJN-ILKKLZGPSA-N |
| SMILES | C1=CC(=NC=C1Br)[C@H](CO)N.Cl.Cl |
Computed by PubChem (NCBI)