CAS 2126136-98-7 appears in our catalog under these names: CCT365623 hydrochloride, CCT365623 hydrochloride, CCT 365623 hydrochloride, CCT365623 (hydrochloride), 98.11%, 98.11%, CCT365623 (hydrochloride), 98.07%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 1mg, 5mg, 10mg, 100 mg, 10 mg.
[5-(3-methylsulfonyl-5-phenylphenyl)sulfonylthiophen-2-yl]methanamine;hydrochloride (CAS 2126136-98-7) is a chemical compound with the molecular formula C18H18ClNO4S3 and a molecular weight of 444.0 g/mol. IUPAC name: [5-(3-methylsulfonyl-5-phenylphenyl)sulfonylthiophen-2-yl]methanamine;hydrochloride. InChIKey: MKBRQENFVVWIGU-UHFFFAOYSA-N.
| Molecular formula | C18H18ClNO4S3 |
|---|---|
| Molecular weight | 444.0 g/mol |
| IUPAC name | [5-(3-methylsulfonyl-5-phenylphenyl)sulfonylthiophen-2-yl]methanamine;hydrochloride |
| InChIKey | MKBRQENFVVWIGU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CC(=C1)C2=CC=CC=C2)S(=O)(=O)C3=CC=C(S3)CN.Cl |
Computed by PubChem (NCBI)