Products 2126144-76-9
CAS 2126144-76-9 is the registry number for rac-tert-Butyl (3R,4R)-1-benzyl-4-cyclopropylpyrrolidine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
Tert-butyl (3S,4S)-1-benzyl-4-cyclopropylpyrrolidine-3-carboxylate (CAS 2126144-76-9) is a chemical compound with the molecular formula C19H27NO2 and a molecular weight of 301.4 g/mol. IUPAC name: tert-butyl (3S,4S)-1-benzyl-4-cyclopropylpyrrolidine-3-carboxylate. InChIKey: DNJMAILPYMRUGJ-DLBZAZTESA-N.
| Molecular formula | C19H27NO2 |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | tert-butyl (3S,4S)-1-benzyl-4-cyclopropylpyrrolidine-3-carboxylate |
| InChIKey | DNJMAILPYMRUGJ-DLBZAZTESA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CN(C[C@H]1C2CC2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)