CAS 2126159-80-4 is the registry number for 1,1,2,2-Tetrafluoro-6-azaspiro(3.4)octane hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 250mg, 100mg, 1g.
2,2,3,3-tetrafluoro-6-azaspiro[3.4]octane;hydrochloride (CAS 2126159-80-4) is a chemical compound with the molecular formula C7H10ClF4N and a molecular weight of 219.61 g/mol. IUPAC name: 2,2,3,3-tetrafluoro-6-azaspiro[3.4]octane;hydrochloride. InChIKey: NXOXUUNNUDHYEX-UHFFFAOYSA-N.
| Molecular formula | C7H10ClF4N |
|---|---|
| Molecular weight | 219.61 g/mol |
| IUPAC name | 2,2,3,3-tetrafluoro-6-azaspiro[3.4]octane;hydrochloride |
| InChIKey | NXOXUUNNUDHYEX-UHFFFAOYSA-N |
| SMILES | C1CNCC12CC(C2(F)F)(F)F.Cl |
Computed by PubChem (NCBI)