CAS 2126160-87-8 is the registry number for (4-Bromo-2,6-dichlorophenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(4-bromo-2,6-dichlorophenyl)methanamine;hydrochloride (CAS 2126160-87-8) is a chemical compound with the molecular formula C7H7BrCl3N and a molecular weight of 291.4 g/mol. IUPAC name: (4-bromo-2,6-dichlorophenyl)methanamine;hydrochloride. InChIKey: JUBMPCBPNMTCRB-UHFFFAOYSA-N.
| Molecular formula | C7H7BrCl3N |
|---|---|
| Molecular weight | 291.4 g/mol |
| IUPAC name | (4-bromo-2,6-dichlorophenyl)methanamine;hydrochloride |
| InChIKey | JUBMPCBPNMTCRB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)CN)Cl)Br.Cl |
Computed by PubChem (NCBI)