CAS 2126161-16-6 appears in our catalog under these names: Lithium(1+) ion 2-(hydroxymethyl)pyridine-3-carboxylate, 95%, 2-(hydroxymethyl)pyridine-3-carboxylate lithium. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Lithium 2-(hydroxymethyl)pyridine-3-carboxylate (CAS 2126161-16-6) is a chemical compound with the molecular formula C7H6LiNO3 and a molecular weight of 159.1 g/mol. IUPAC name: lithium 2-(hydroxymethyl)pyridine-3-carboxylate. InChIKey: NCKGMLLGAPKZAQ-UHFFFAOYSA-M.
| Molecular formula | C7H6LiNO3 |
|---|---|
| Molecular weight | 159.1 g/mol |
| IUPAC name | lithium 2-(hydroxymethyl)pyridine-3-carboxylate |
| InChIKey | NCKGMLLGAPKZAQ-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC(=C(N=C1)CO)C(=O)[O-] |
Computed by PubChem (NCBI)