Products 2126161-79-1
CAS 2126161-79-1 is the registry number for 1-Hydroxypropan-2-yl 2-(3-benzoylphenyl)propanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-hydroxypropan-2-yl 2-(3-benzoylphenyl)propanoate (CAS 2126161-79-1) is a chemical compound with the molecular formula C19H20O4 and a molecular weight of 312.4 g/mol. IUPAC name: 1-hydroxypropan-2-yl 2-(3-benzoylphenyl)propanoate. InChIKey: FYNTXLVRERRBDV-UHFFFAOYSA-N.
| Molecular formula | C19H20O4 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 1-hydroxypropan-2-yl 2-(3-benzoylphenyl)propanoate |
| InChIKey | FYNTXLVRERRBDV-UHFFFAOYSA-N |
| SMILES | CC(CO)OC(=O)C(C)C1=CC(=CC=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)