CAS 2126162-51-2 is the registry number for 2-(4-cyanopyridin-2-yl)acetate lithium (I). Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Lithium 2-(4-cyano-2-pyridinyl)acetate (CAS 2126162-51-2) is a chemical compound with the molecular formula C8H5LiN2O2 and a molecular weight of 168.1 g/mol. IUPAC name: lithium 2-(4-cyano-2-pyridinyl)acetate. InChIKey: VJXUEGQLIFYTPN-UHFFFAOYSA-M.
| Molecular formula | C8H5LiN2O2 |
|---|---|
| Molecular weight | 168.1 g/mol |
| IUPAC name | lithium 2-(4-cyano-2-pyridinyl)acetate |
| InChIKey | VJXUEGQLIFYTPN-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CN=C(C=C1C#N)CC(=O)[O-] |
Computed by PubChem (NCBI)