CAS 2126177-26-0 is the registry number for 5-(2-Methanesulfonylpropan-2-yl)-2H-1,2,3,4-tetrazole. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-(2-methylsulfonylpropan-2-yl)-2H-tetrazole (CAS 2126177-26-0) is a chemical compound with the molecular formula C5H10N4O2S and a molecular weight of 190.23 g/mol. IUPAC name: 5-(2-methylsulfonylpropan-2-yl)-2H-tetrazole. InChIKey: PBZINAWYZOIXGX-UHFFFAOYSA-N.
| Molecular formula | C5H10N4O2S |
|---|---|
| Molecular weight | 190.23 g/mol |
| IUPAC name | 5-(2-methylsulfonylpropan-2-yl)-2H-tetrazole |
| InChIKey | PBZINAWYZOIXGX-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NNN=N1)S(=O)(=O)C |
Computed by PubChem (NCBI)