CAS 2126177-38-4 appears in our catalog under these names: 4-(4-Bromobenzyl)-2,6-dimethylmorpholine hydrochloride, 98%, 4-((4-Bromophenyl)methyl)-2,6-dimethylmorpholine hydrochloride, 4-[(4-bromophenyl)methyl]-2,6-dimethylmorpholine hydrochloride, 95%. Offered by: AmBeed, Biosynth, Combi-blocks. Available pack sizes: 10g, 5g, 0,5g, 1g, 250mg, 100mg.
4-[(4-bromophenyl)methyl]-2,6-dimethylmorpholine;hydrochloride (CAS 2126177-38-4) is a chemical compound with the molecular formula C13H19BrClNO and a molecular weight of 320.65 g/mol. IUPAC name: 4-[(4-bromophenyl)methyl]-2,6-dimethylmorpholine;hydrochloride. InChIKey: VOILBQVKDQZIOX-UHFFFAOYSA-N.
| Molecular formula | C13H19BrClNO |
|---|---|
| Molecular weight | 320.65 g/mol |
| IUPAC name | 4-[(4-bromophenyl)methyl]-2,6-dimethylmorpholine;hydrochloride |
| InChIKey | VOILBQVKDQZIOX-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)CC2=CC=C(C=C2)Br.Cl |
Computed by PubChem (NCBI)