CAS 2126178-89-8 is the registry number for 2-(Aminomethyl)-4,6-dibromoaniline dihydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(aminomethyl)-4,6-dibromoaniline;dihydrochloride (CAS 2126178-89-8) is a chemical compound with the molecular formula C7H10Br2Cl2N2 and a molecular weight of 352.88 g/mol. IUPAC name: 2-(aminomethyl)-4,6-dibromoaniline;dihydrochloride. InChIKey: GWFJDDVDFQLOOF-UHFFFAOYSA-N.
| Molecular formula | C7H10Br2Cl2N2 |
|---|---|
| Molecular weight | 352.88 g/mol |
| IUPAC name | 2-(aminomethyl)-4,6-dibromoaniline;dihydrochloride |
| InChIKey | GWFJDDVDFQLOOF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CN)N)Br)Br.Cl.Cl |
Computed by PubChem (NCBI)