CAS 212632-22-9 appears in our catalog under these names: Z-Thr(tBu)-OBzl, 97%, (2S,3R)-Benzyl 2-(((benzyloxy)carbonyl)amino)-3-(tert-butoxy)butanoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 10g, 1g.
Benzyl (2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)butanoate (CAS 212632-22-9) is a chemical compound with the molecular formula C23H29NO5 and a molecular weight of 399.5 g/mol. IUPAC name: benzyl (2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: LKKBIFVMIYWAGA-XLIONFOSSA-N.
| Molecular formula | C23H29NO5 |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | benzyl (2S,3R)-3-[(2-methylpropan-2-yl)oxy]-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | LKKBIFVMIYWAGA-XLIONFOSSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OCC1=CC=CC=C1)NC(=O)OCC2=CC=CC=C2)OC(C)(C)C |
Computed by PubChem (NCBI)