CAS 2126821-86-9 appears in our catalog under these names: Potassium (3,4-difluorobenzyl)trifluoroborate, 98%, 98%, Potassium (3,4-difluorobenzyl)trifluoroborate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Potassium (3,4-difluorophenyl)methyl-trifluoroboranuide (CAS 2126821-86-9) is a chemical compound with the molecular formula C7H5BF5K and a molecular weight of 234.02 g/mol. IUPAC name: potassium (3,4-difluorophenyl)methyl-trifluoroboranuide. InChIKey: VXSISNWMCYIWFN-UHFFFAOYSA-N.
| Molecular formula | C7H5BF5K |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | potassium (3,4-difluorophenyl)methyl-trifluoroboranuide |
| InChIKey | VXSISNWMCYIWFN-UHFFFAOYSA-N |
| SMILES | [B-](CC1=CC(=C(C=C1)F)F)(F)(F)F.[K+] |
Computed by PubChem (NCBI)