Products 2127158-11-4

CAS 2127158-11-4 appears in our catalog under these names: (1,1':3',1''–Terphenyl)–3,3'',5'–tricarboxylic acid, [1,1':3',1''-Terphenyl]-3,3'',5'-tricarboxylic acid 97%, [1,1':3',1''-Terphenyl]-3,3'',5'-tricarboxylic acid, 97%, 97%, [1,1':3',1''-Terphenyl]-3,3'',5'-tricarboxylic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.

Structural formula: {0} (CAS {1})

3,5-bis(3-carboxyphenyl)benzoic acid (CAS 2127158-11-4) is a chemical compound with the molecular formula C21H14O6 and a molecular weight of 362.3 g/mol. IUPAC name: 3,5-bis(3-carboxyphenyl)benzoic acid. InChIKey: WCDYDZCJRQPZQU-UHFFFAOYSA-N.

Identity
Molecular formulaC21H14O6
Molecular weight362.3 g/mol
IUPAC name3,5-bis(3-carboxyphenyl)benzoic acid
InChIKeyWCDYDZCJRQPZQU-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)C2=CC(=CC(=C2)C(=O)O)C3=CC(=CC=C3)C(=O)O

Computed by PubChem (NCBI)