Products 2127387-94-2

CAS 2127387-94-2 is the registry number for BGT-002. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 50 mg, 10 mg.

Structural formula: {0} (CAS {1})

(E)-2,2,14,14-tetramethylpentadec-7-enedioic acid (CAS 2127387-94-2) is a chemical compound with the molecular formula C19H34O4 and a molecular weight of 326.5 g/mol. IUPAC name: (E)-2,2,14,14-tetramethylpentadec-7-enedioic acid. InChIKey: UUPWWWGROSGLPP-AATRIKPKSA-N.

Identity
Molecular formulaC19H34O4
Molecular weight326.5 g/mol
IUPAC name(E)-2,2,14,14-tetramethylpentadec-7-enedioic acid
InChIKeyUUPWWWGROSGLPP-AATRIKPKSA-N
SMILESCC(C)(CCCCC/C=C/CCCCC(C)(C)C(=O)O)C(=O)O

Computed by PubChem (NCBI)