CAS 2127391-58-4 appears in our catalog under these names: Cl–C6–PEG4–C3–COOH, Cl-C6-PEG4-C3-COOH 98%, Cl-C6-PEG4-C3-COOH, 98%, 98%, Cl-C6-PEG4-C3-COOH, 99.65%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 100 mg, 10 mg, 50 mg.
6-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]hexanoic acid (CAS 2127391-58-4) is a chemical compound with the molecular formula C18H35ClO6 and a molecular weight of 382.9 g/mol. IUPAC name: 6-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]hexanoic acid. InChIKey: DQFXVBKFPVKFQX-UHFFFAOYSA-N.
| Molecular formula | C18H35ClO6 |
|---|---|
| Molecular weight | 382.9 g/mol |
| IUPAC name | 6-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]hexanoic acid |
| InChIKey | DQFXVBKFPVKFQX-UHFFFAOYSA-N |
| SMILES | C(CCCCl)CCOCCOCCOCCOCCCCCC(=O)O |
Computed by PubChem (NCBI)