CAS 212779-48-1 appears in our catalog under these names: Ng 52, 95%, NG 52/ 99.36% (existing batch purity), NG 52 99%, NG 52, 99.88%, NG 52 (Standard). Offered by: Combi-blocks, TargetMol, Ambeed, MedChemExpress, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 200mg, 250mg.
2-[[6-(3-chloroanilino)-9-propan-2-ylpurin-2-yl]amino]ethanol (CAS 212779-48-1) is a chemical compound with the molecular formula C16H19ClN6O and a molecular weight of 346.81 g/mol. IUPAC name: 2-[[6-(3-chloroanilino)-9-propan-2-ylpurin-2-yl]amino]ethanol. InChIKey: XZEFMZCNXDQXOZ-UHFFFAOYSA-N.
| Molecular formula | C16H19ClN6O |
|---|---|
| Molecular weight | 346.81 g/mol |
| IUPAC name | 2-[[6-(3-chloroanilino)-9-propan-2-ylpurin-2-yl]amino]ethanol |
| InChIKey | XZEFMZCNXDQXOZ-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=NC2=C(N=C(N=C21)NCCO)NC3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)