CAS 21280-40-0 is the registry number for Methyl 1-adamantanesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl adamantane-1-sulfonate (CAS 21280-40-0) is a chemical compound with the molecular formula C11H18O3S and a molecular weight of 230.33 g/mol. IUPAC name: methyl adamantane-1-sulfonate. InChIKey: DDWYYQDVBUEDSI-UHFFFAOYSA-N.
| Molecular formula | C11H18O3S |
|---|---|
| Molecular weight | 230.33 g/mol |
| IUPAC name | methyl adamantane-1-sulfonate |
| InChIKey | DDWYYQDVBUEDSI-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)C12CC3CC(C1)CC(C3)C2 |
Computed by PubChem (NCBI)