Products 212845-61-9
CAS 212845-61-9 appears in our catalog under these names: 6-Fluorochroman-8-amine, 98%, 6-Fluoro-3,4-dihydro-2H-1-benzopyran-8-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 0,5g, 50mg.
6-fluoro-3,4-dihydro-2H-chromen-8-amine (CAS 212845-61-9) is a chemical compound with the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. IUPAC name: 6-fluoro-3,4-dihydro-2H-chromen-8-amine. InChIKey: AEICTTXLAITIQJ-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO |
|---|---|
| Molecular weight | 167.18 g/mol |
| IUPAC name | 6-fluoro-3,4-dihydro-2H-chromen-8-amine |
| InChIKey | AEICTTXLAITIQJ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)F)N)OC1 |
Computed by PubChem (NCBI)