Products 2128735-24-8
CAS 2128735-24-8 appears in our catalog under these names: Mal-nh-ethyl-ss-propionic acid, 95%, Mal-NH-ethyl-SS-propionic acid, 98%, Mal-NH-ethyl-SS-propionic acid, Mal–NH–ethyl–SS–propionic acid, Mal-SS-COOH. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Iris Biotech. Available pack sizes: 100mg, 250mg, 25mg, 2mg, 50mg, 1g, 25 mg, 100 mg.
3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyldisulfanyl]propanoic acid (CAS 2128735-24-8) is a chemical compound with the molecular formula C12H16N2O5S2 and a molecular weight of 332.4 g/mol. IUPAC name: 3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyldisulfanyl]propanoic acid. InChIKey: MQYOVZAKKXDVHK-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O5S2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyldisulfanyl]propanoic acid |
| InChIKey | MQYOVZAKKXDVHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCC(=O)NCCSSCCC(=O)O |
Computed by PubChem (NCBI)