CAS 2129597-38-0 appears in our catalog under these names: Sodium Methanesulfinate-d3, 98 atom % D, min 98% Chemical Purity, Sodium Methanesulfonate-d3, >95% (HPLC), Sodium methanesulfinate-d3. Offered by: CDN, TRC, MedChemExpress. Available pack sizes: 0,05g, 25mg, 50mg, 5mg, 50 mg, 25 mg, 5 mg.
Sodium trideuteriomethanesulfinate (CAS 2129597-38-0) is a chemical compound with the molecular formula CH3NaO2S and a molecular weight of 105.11 g/mol. IUPAC name: sodium trideuteriomethanesulfinate. InChIKey: LYPGDCWPTHTUDO-NIIDSAIPSA-M.
| Molecular formula | CH3NaO2S |
|---|---|
| Molecular weight | 105.11 g/mol |
| IUPAC name | sodium trideuteriomethanesulfinate |
| InChIKey | LYPGDCWPTHTUDO-NIIDSAIPSA-M |
| SMILES | [2H]C([2H])([2H])S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)