Products 2130017-23-9
CAS 2130017-23-9 is the registry number for methyl 2-fluoro-5-(3-oxocyclobutyl)benzoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-fluoro-5-(3-oxocyclobutyl)benzoate (CAS 2130017-23-9) is a chemical compound with the molecular formula C12H11FO3 and a molecular weight of 222.21 g/mol. IUPAC name: methyl 2-fluoro-5-(3-oxocyclobutyl)benzoate. InChIKey: RNUFRFUEAOMFPB-UHFFFAOYSA-N.
| Molecular formula | C12H11FO3 |
|---|---|
| Molecular weight | 222.21 g/mol |
| IUPAC name | methyl 2-fluoro-5-(3-oxocyclobutyl)benzoate |
| InChIKey | RNUFRFUEAOMFPB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C2CC(=O)C2)F |
Computed by PubChem (NCBI)