CAS 104201-85-6 appears in our catalog under these names: (1R,2R)-2-(4-fluorophenyl)-4-oxocyclopentane-1-carboxylic acid, 97%, (1R,2R)-2-(4-fluorophenyl)-4-oxocyclopentane-1-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
Trans-(1R,2R)-2-(4-fluorophenyl)-4-oxocyclopentane-1-carboxylic acid (CAS 104201-85-6) is a chemical compound with the molecular formula C12H11FO3 and a molecular weight of 222.21 g/mol. IUPAC name: trans-(1R,2R)-2-(4-fluorophenyl)-4-oxocyclopentane-1-carboxylic acid. InChIKey: GBHRFYWHAGRHBU-WDEREUQCSA-N.
| Molecular formula | C12H11FO3 |
|---|---|
| Molecular weight | 222.21 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-fluorophenyl)-4-oxocyclopentane-1-carboxylic acid |
| InChIKey | GBHRFYWHAGRHBU-WDEREUQCSA-N |
| SMILES | C1[C@H]([C@@H](CC1=O)C(=O)O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)