CAS 2130753-07-8 is the registry number for 6–(tert–Butylthio)benzo(c)(1,2)oxaborol–1(3H)–ol. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
6-tert-butylsulfanyl-1-hydroxy-3H-2,1-benzoxaborole (CAS 2130753-07-8) is a chemical compound with the molecular formula C11H15BO2S and a molecular weight of 222.12 g/mol. IUPAC name: 6-tert-butylsulfanyl-1-hydroxy-3H-2,1-benzoxaborole. InChIKey: QGSCAYUNVNVZJL-UHFFFAOYSA-N.
| Molecular formula | C11H15BO2S |
|---|---|
| Molecular weight | 222.12 g/mol |
| IUPAC name | 6-tert-butylsulfanyl-1-hydroxy-3H-2,1-benzoxaborole |
| InChIKey | QGSCAYUNVNVZJL-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=CC(=C2)SC(C)(C)C)O |
Computed by PubChem (NCBI)