Products 2130882-23-2

CAS 2130882-23-2 is the registry number for PTX-M, 99.95%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg.

Structural formula: {0} (CAS {1})

4-(3,7-dimethyl-2,6-dioxopurin-1-yl)butyl acetate (CAS 2130882-23-2) is a chemical compound with the molecular formula C13H18N4O4 and a molecular weight of 294.31 g/mol. IUPAC name: 4-(3,7-dimethyl-2,6-dioxopurin-1-yl)butyl acetate. InChIKey: ZNWBPFHCRWQYOP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18N4O4
Molecular weight294.31 g/mol
IUPAC name4-(3,7-dimethyl-2,6-dioxopurin-1-yl)butyl acetate
InChIKeyZNWBPFHCRWQYOP-UHFFFAOYSA-N
SMILESCC(=O)OCCCCN1C(=O)C2=C(N=CN2C)N(C1=O)C

Computed by PubChem (NCBI)