CAS 2130896-19-2 appears in our catalog under these names: 5-Chloro-6-morpholinopyridine-3-boronic acid, 98%, 5–Chloro–6–(morpholino)pyridine–3–boronic acid, 5-Chloro-6-morpholinopyridine-3-boronic acid 98%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 250mg, 1g, 10mg, 25mg, 5g.
(5-chloro-6-morpholin-4-yl-3-pyridinyl)boronic acid (CAS 2130896-19-2) is a chemical compound with the molecular formula C9H12BClN2O3 and a molecular weight of 242.47 g/mol. IUPAC name: (5-chloro-6-morpholin-4-yl-3-pyridinyl)boronic acid. InChIKey: MWNZQPQVKHVBEP-UHFFFAOYSA-N.
| Molecular formula | C9H12BClN2O3 |
|---|---|
| Molecular weight | 242.47 g/mol |
| IUPAC name | (5-chloro-6-morpholin-4-yl-3-pyridinyl)boronic acid |
| InChIKey | MWNZQPQVKHVBEP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)N2CCOCC2)Cl)(O)O |
Computed by PubChem (NCBI)