CAS 2130971-14-9 appears in our catalog under these names: Macitentan Impurity 31, Macitentan Impurity 19. Offered by: Chemat Brand. Available pack sizes: on request.
(2-methylpropan-2-yl)oxycarbonylsulfamic acid (CAS 2130971-14-9) is a chemical compound with the molecular formula C5H11NO5S and a molecular weight of 197.21 g/mol. IUPAC name: (2-methylpropan-2-yl)oxycarbonylsulfamic acid. InChIKey: PTDZGJNEPIRDTH-UHFFFAOYSA-N.
| Molecular formula | C5H11NO5S |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | (2-methylpropan-2-yl)oxycarbonylsulfamic acid |
| InChIKey | PTDZGJNEPIRDTH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)O |
Computed by PubChem (NCBI)