Products 2131-60-4

CAS 2131-60-4 is the registry number for 4-Isothiocyanatophenol. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 5g, 0,5g, 1g, 2g, 10g.

Structural formula: {0} (CAS {1})

4-isothiocyanatophenol (CAS 2131-60-4) is a chemical compound with the molecular formula C7H5NOS and a molecular weight of 151.19 g/mol. IUPAC name: 4-isothiocyanatophenol. InChIKey: HIPHYBWWZWRZOV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5NOS
Molecular weight151.19 g/mol
IUPAC name4-isothiocyanatophenol
InChIKeyHIPHYBWWZWRZOV-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1N=C=S)O

Computed by PubChem (NCBI)