Products 2131173-58-3
CAS 2131173-58-3 is the registry number for AB–CHMINACA metabolite M3A. Offered by: GLPBio. Available pack sizes: 1mg, 5mg, 500μg.
(2S)-2-[[1-[(4-hydroxycyclohexyl)methyl]indazole-3-carbonyl]amino]-3-methylbutanoic acid (CAS 2131173-58-3) is a chemical compound with the molecular formula C20H27N3O4 and a molecular weight of 373.4 g/mol. IUPAC name: (2S)-2-[[1-[(4-hydroxycyclohexyl)methyl]indazole-3-carbonyl]amino]-3-methylbutanoic acid. InChIKey: DGLBMACIGDZWJF-KVULBXGLSA-N.
| Molecular formula | C20H27N3O4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | (2S)-2-[[1-[(4-hydroxycyclohexyl)methyl]indazole-3-carbonyl]amino]-3-methylbutanoic acid |
| InChIKey | DGLBMACIGDZWJF-KVULBXGLSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)C1=NN(C2=CC=CC=C21)CC3CCC(CC3)O |
Computed by PubChem (NCBI)