CAS 2131742-03-3 appears in our catalog under these names: 6-chloro-3-iodo-1H-pyrazolo(3,4-d)pyrimidin-4(5H)-one, 95%, 4H-Pyrazolo[3,4-d]pyrimidin-4-one, 6-chloro-1,5-dihydro-3-iodo-, 95%, 95%, 6-chloro-3-iodo-1H,4H,7H-pyrazolo[3,4-d]pyrimidin-4-one, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
6-chloro-3-iodo-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one (CAS 2131742-03-3) is a chemical compound with the molecular formula C5H2ClIN4O and a molecular weight of 296.45 g/mol. IUPAC name: 6-chloro-3-iodo-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one. InChIKey: RIEBRYTVLQKGDX-UHFFFAOYSA-N.
| Molecular formula | C5H2ClIN4O |
|---|---|
| Molecular weight | 296.45 g/mol |
| IUPAC name | 6-chloro-3-iodo-2,5-dihydropyrazolo[3,4-d]pyrimidin-4-one |
| InChIKey | RIEBRYTVLQKGDX-UHFFFAOYSA-N |
| SMILES | C12=C(NN=C1N=C(NC2=O)Cl)I |
Computed by PubChem (NCBI)