CAS 2131782-57-3 appears in our catalog under these names: (6-Bromo-2-methoxyquinolin-3-yl)boronic acid, (6-Bromo-2-methoxyquinolin-3-yl)boronic acid, 98%, 98%, (6-Bromo-2-methoxyquinolin-3-yl)boronic acid, 98%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
(6-bromo-2-methoxyquinolin-3-yl)boronic acid (CAS 2131782-57-3) is a chemical compound with the molecular formula C10H9BBrNO3 and a molecular weight of 281.90 g/mol. IUPAC name: (6-bromo-2-methoxyquinolin-3-yl)boronic acid. InChIKey: ZMKAPPVKZFURTH-UHFFFAOYSA-N.
| Molecular formula | C10H9BBrNO3 |
|---|---|
| Molecular weight | 281.90 g/mol |
| IUPAC name | (6-bromo-2-methoxyquinolin-3-yl)boronic acid |
| InChIKey | ZMKAPPVKZFURTH-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=CC(=C2)Br)N=C1OC)(O)O |
Computed by PubChem (NCBI)