CAS 2131799-32-9 is the registry number for Tert-butyl((3-cyclopentylideneallyl)oxy)dimethylsilane, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl-(3-cyclopentylideneprop-2-enoxy)-dimethylsilane (CAS 2131799-32-9) is a chemical compound with the molecular formula C14H26OSi and a molecular weight of 238.44 g/mol. IUPAC name: tert-butyl-(3-cyclopentylideneprop-2-enoxy)-dimethylsilane. InChIKey: PGRFJSMQKWLUGH-UHFFFAOYSA-N.
| Molecular formula | C14H26OSi |
|---|---|
| Molecular weight | 238.44 g/mol |
| IUPAC name | tert-butyl-(3-cyclopentylideneprop-2-enoxy)-dimethylsilane |
| InChIKey | PGRFJSMQKWLUGH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC=C=C1CCCC1 |
Computed by PubChem (NCBI)